C14H17IN2OS — CID 135882348
2-[(E)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium iodide (PubChem CID 135882348) has the molecular formula C14H17IN2OS and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-[(E)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium iodide.
| Compound Name | 2-[(E)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium iodide |
|---|---|
| PubChem CID | 135882348 |
| Molecular Formula | C14H17IN2OS |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-[(E)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium iodide |
| SMILES | CCN1CCS/C1=C/c1oc2ccccc2[n+]1C.[I-] |
| InChI | InChI=1S/C14H17N2OS.HI/c1-3-16-8-9-18-14(16)10-13-15(2)11-6-4-5-7-12(11)17-13;/h4-7,10H,3,8-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KOHSJDVQACKAQO-UHFFFAOYSA-M |
| XLogP | -0.37 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|