C25H22N5O+ — CID 3698023
2-[(3-ethyl-1-methylimidazo[4,5-b]phenazin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium (PubChem CID 3698023) has the molecular formula C25H22N5O+ and a molecular weight of 408.49 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylimidazo[4,5-b]phenazin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium.
| Compound Name | 2-[(3-ethyl-1-methylimidazo[4,5-b]phenazin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 3698023 |
| Molecular Formula | C25H22N5O+ |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[(3-ethyl-1-methylimidazo[4,5-b]phenazin-2-ylidene)methyl]-3-methyl-1,3-benzoxazol-3-ium |
| SMILES | CCN1C(=Cc2oc3ccccc3[n+]2C)N(C)c2cc3nc4ccccc4nc3cc21 |
| InChI | InChI=1S/C25H22N5O/c1-4-30-22-14-19-18(26-16-9-5-6-10-17(16)27-19)13-21(22)28(2)24(30)15-25-29(3)20-11-7-8-12-23(20)31-25/h5-15H,4H2,1-3H3/q+1 |
| InChIKey | ZXIINUNSQHDUPO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|