C23H25BrN3S+ — CID 5217298
2-[3-[1-(4-bromophenyl)-3-ethylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-thiazolidine (PubChem CID 5217298) has the molecular formula C23H25BrN3S+ and a molecular weight of 455.45 g/mol. Its IUPAC name is 2-[3-[1-(4-bromophenyl)-3-ethylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-thiazolidine.
| Compound Name | 2-[3-[1-(4-bromophenyl)-3-ethylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 5217298 |
| Molecular Formula | C23H25BrN3S+ |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-[3-[1-(4-bromophenyl)-3-ethylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-thiazolidine |
| SMILES | CCN1CCSC1=CC=Cc1n(-c2ccc(Br)cc2)c2ccccc2[n+]1CC |
| InChI | InChI=1S/C23H25BrN3S/c1-3-25-16-17-28-23(25)11-7-10-22-26(4-2)20-8-5-6-9-21(20)27(22)19-14-12-18(24)13-15-19/h5-15H,3-4,16-17H2,1-2H3/q+1 |
| InChIKey | OPCUNLDIBDXTOR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|