C49H39N6O+ — CID 136568635
2-[3-ethyl-2-[(Z,3Z)-3-(3-ethyl-1-phenyl-5-quinolin-2-ylbenzimidazol-2-ylidene)prop-1-enyl]-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole (PubChem CID 136568635) has the molecular formula C49H39N6O+ and a molecular weight of 727.89 g/mol. Its IUPAC name is 2-[3-ethyl-2-[(Z,3Z)-3-(3-ethyl-1-phenyl-5-quinolin-2-ylbenzimidazol-2-ylidene)prop-1-enyl]-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole.
| Compound Name | 2-[3-ethyl-2-[(Z,3Z)-3-(3-ethyl-1-phenyl-5-quinolin-2-ylbenzimidazol-2-ylidene)prop-1-enyl]-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 136568635 |
| Molecular Formula | C49H39N6O+ |
| Molecular Weight | 727.89 g/mol |
| Exact Mass | 727.32 |
| IUPAC Name | 2-[3-ethyl-2-[(Z,3Z)-3-(3-ethyl-1-phenyl-5-quinolin-2-ylbenzimidazol-2-ylidene)prop-1-enyl]-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole |
| SMILES | CCN1/C(=C/C=C\c2n(-c3ccccc3)c3ccc(-c4nc5ccccc5o4)cc3[n+]2CC)N(c2ccccc2)c2ccc(-c3ccc4ccccc4n3)cc21 |
| InChI | InChI=1S/C49H39N6O/c1-3-52-44-32-35(40-29-26-34-16-11-12-21-39(34)50-40)27-30-42(44)54(37-17-7-5-8-18-37)47(52)24-15-25-48-53(4-2)45-33-36(49-51-41-22-13-14-23-46(41)56-49)28-31-43(45)55(48)38-19-9-6-10-20-38/h5-33H,3-4H2,1-2H3/q+1 |
| InChIKey | NQTPWQGJVWAXDW-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 54.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.89 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|