C45H39N4O+ — CID 88893014
2-[2-[(1E,3E,5E,7E)-7-(3,3-dimethyl-1-phenylindol-2-ylidene)hepta-1,3,5-trienyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole (PubChem CID 88893014) has the molecular formula C45H39N4O+ and a molecular weight of 651.83 g/mol. Its IUPAC name is 2-[2-[(1E,3E,5E,7E)-7-(3,3-dimethyl-1-phenylindol-2-ylidene)hepta-1,3,5-trienyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole.
| Compound Name | 2-[2-[(1E,3E,5E,7E)-7-(3,3-dimethyl-1-phenylindol-2-ylidene)hepta-1,3,5-trienyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 88893014 |
| Molecular Formula | C45H39N4O+ |
| Molecular Weight | 651.83 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 2-[2-[(1E,3E,5E,7E)-7-(3,3-dimethyl-1-phenylindol-2-ylidene)hepta-1,3,5-trienyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-yl]-1,3-benzoxazole |
| SMILES | CC[n+]1c(/C=C/C=C/C=C/C=C2/N(c3ccccc3)c3ccccc3C2(C)C)n(-c2ccccc2)c2ccc(-c3nc4ccccc4o3)cc21 |
| InChI | InChI=1S/C45H39N4O/c1-4-47-40-32-33(44-46-37-25-17-19-27-41(37)50-44)30-31-39(40)49(35-22-12-9-13-23-35)43(47)29-15-7-5-6-14-28-42-45(2,3)36-24-16-18-26-38(36)48(42)34-20-10-8-11-21-34/h5-32H,4H2,1-3H3/q+1 |
| InChIKey | HGEZDVGEOXVUAO-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.83 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|