C41H34N5O2S+ — CID 4117651
2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-carboxylic acid (PubChem CID 4117651) has the molecular formula C41H34N5O2S+ and a molecular weight of 660.82 g/mol. Its IUPAC name is 2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-carboxylic acid.
| Compound Name | 2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 4117651 |
| Molecular Formula | C41H34N5O2S+ |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-1-phenylbenzimidazol-3-ium-5-carboxylic acid |
| SMILES | CCN1C(=CC=Cc2n(-c3ccccc3)c3ccc(C(=O)O)cc3[n+]2CC)N(c2ccccc2)c2ccc(-c3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C41H33N5O2S/c1-3-43-35-26-28(40-42-32-18-11-12-19-37(32)49-40)22-24-33(35)45(30-14-7-5-8-15-30)38(43)20-13-21-39-44(4-2)36-27-29(41(47)48)23-25-34(36)46(39)31-16-9-6-10-17-31/h5-27H,3-4H2,1-2H3/p+1 |
| InChIKey | AQZGUFJIMRSXOS-UHFFFAOYSA-O |
| XLogP | 9.45 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|