C30H24N3S+ — CID 51349824
2-[3-ethyl-1-phenyl-2-[(E)-2-phenylethenyl]benzimidazol-3-ium-5-yl]-1,3-benzothiazole (PubChem CID 51349824) has the molecular formula C30H24N3S+ and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[3-ethyl-1-phenyl-2-[(E)-2-phenylethenyl]benzimidazol-3-ium-5-yl]-1,3-benzothiazole.
| Compound Name | 2-[3-ethyl-1-phenyl-2-[(E)-2-phenylethenyl]benzimidazol-3-ium-5-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 51349824 |
| Molecular Formula | C30H24N3S+ |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[3-ethyl-1-phenyl-2-[(E)-2-phenylethenyl]benzimidazol-3-ium-5-yl]-1,3-benzothiazole |
| SMILES | CC[n+]1c(/C=C/c2ccccc2)n(-c2ccccc2)c2ccc(-c3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C30H24N3S/c1-2-32-27-21-23(30-31-25-15-9-10-16-28(25)34-30)18-19-26(27)33(24-13-7-4-8-14-24)29(32)20-17-22-11-5-3-6-12-22/h3-21H,2H2,1H3/q+1/b20-17+ |
| InChIKey | HBGOJTKLUXCSBF-LVZFUZTISA-N |
| XLogP | 7.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|