C31H31N4S+ — CID 23748711
N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylcyclohexen-1-amine (PubChem CID 23748711) has the molecular formula C31H31N4S+ and a molecular weight of 491.68 g/mol. Its IUPAC name is N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylcyclohexen-1-amine.
| Compound Name | N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylcyclohexen-1-amine |
|---|---|
| PubChem CID | 23748711 |
| Molecular Formula | C31H31N4S+ |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[(E)-2-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]ethenyl]-N-methylcyclohexen-1-amine |
| SMILES | CC[n+]1c(/C=C/N(C)C2=CCCCC2)n(-c2ccccc2)c2ccc(-c3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C31H31N4S/c1-3-34-28-22-23(31-32-26-16-10-11-17-29(26)36-31)18-19-27(28)35(25-14-8-5-9-15-25)30(34)20-21-33(2)24-12-6-4-7-13-24/h5,8-12,14-22H,3-4,6-7,13H2,1-2H3/q+1 |
| InChIKey | HSGUAJWJDFANQV-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|