C23H24FN2O3S+ — CID 76518023
2-[2-[3-(3-ethyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-6-(2-fluoroethoxy)-1,3-benzothiazol-3-ium-3-yl]ethanol (PubChem CID 76518023) has the molecular formula C23H24FN2O3S+ and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[2-[3-(3-ethyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-6-(2-fluoroethoxy)-1,3-benzothiazol-3-ium-3-yl]ethanol.
| Compound Name | 2-[2-[3-(3-ethyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-6-(2-fluoroethoxy)-1,3-benzothiazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 76518023 |
| Molecular Formula | C23H24FN2O3S+ |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[2-[3-(3-ethyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-6-(2-fluoroethoxy)-1,3-benzothiazol-3-ium-3-yl]ethanol |
| SMILES | CCN1C(=CC=Cc2sc3cc(OCCF)ccc3[n+]2CCO)Oc2ccccc21 |
| InChI | InChI=1S/C23H24FN2O3S/c1-2-25-18-6-3-4-7-20(18)29-22(25)8-5-9-23-26(13-14-27)19-11-10-17(28-15-12-24)16-21(19)30-23/h3-11,16,27H,2,12-15H2,1H3/q+1 |
| InChIKey | WEDLUAFKVRUNDC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|