C40H50ClN2O3+ — CID 158378416
2-[(E)-(5-chloro-3-decyl-1,3-benzoxazol-2-ylidene)methyl]-3-hydroxy-4-[(1-octylquinolin-1-ium-4-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 158378416) has the molecular formula C40H50ClN2O3+ and a molecular weight of 642.30 g/mol. Its IUPAC name is 2-[(E)-(5-chloro-3-decyl-1,3-benzoxazol-2-ylidene)methyl]-3-hydroxy-4-[(1-octylquinolin-1-ium-4-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | 2-[(E)-(5-chloro-3-decyl-1,3-benzoxazol-2-ylidene)methyl]-3-hydroxy-4-[(1-octylquinolin-1-ium-4-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 158378416 |
| Molecular Formula | C40H50ClN2O3+ |
| Molecular Weight | 642.30 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | 2-[(E)-(5-chloro-3-decyl-1,3-benzoxazol-2-ylidene)methyl]-3-hydroxy-4-[(1-octylquinolin-1-ium-4-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | CCCCCCCCCCN1/C(=C\C2=C(O)C(=Cc3cc[n+](CCCCCCCC)c4ccccc34)C2=O)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C40H49ClN2O3/c1-3-5-7-9-11-12-14-18-25-43-36-28-31(41)21-22-37(36)46-38(43)29-34-39(44)33(40(34)45)27-30-23-26-42(24-17-13-10-8-6-4-2)35-20-16-15-19-32(30)35/h15-16,19-23,26-29H,3-14,17-18,24-25H2,1-2H3/p+1 |
| InChIKey | ZNHCKYHMMQJWIJ-UHFFFAOYSA-O |
| XLogP | 10.80 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.30 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|