C34H36N2O5S — CID 12003534
(2Z)-2-[(E)-3-[10-(5-carboxypentyl)acridin-10-ium-9-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate (PubChem CID 12003534) has the molecular formula C34H36N2O5S and a molecular weight of 584.74 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-[10-(5-carboxypentyl)acridin-10-ium-9-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate.
| Compound Name | (2Z)-2-[(E)-3-[10-(5-carboxypentyl)acridin-10-ium-9-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 12003534 |
| Molecular Formula | C34H36N2O5S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (2Z)-2-[(E)-3-[10-(5-carboxypentyl)acridin-10-ium-9-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
| SMILES | CCN1/C(=C\C=C\c2c3ccccc3[n+](CCCCCC(=O)O)c3ccccc23)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C34H36N2O5S/c1-4-35-31-21-20-24(42(39,40)41)23-28(31)34(2,3)32(35)18-12-15-25-26-13-7-9-16-29(26)36(22-11-5-6-19-33(37)38)30-17-10-8-14-27(25)30/h7-10,12-18,20-21,23H,4-6,11,19,22H2,1-3H3,(H-,37,38,39,40,41) |
| InChIKey | VBVWMYJBJQNVOF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|