C26H23N2O2+ — CID 71036058
(2Z)-2-[(6-methoxy-1-methylquinolin-1-ium-2-yl)methylidene]-3-methyl-5-phenyl-1,3-benzoxazole (PubChem CID 71036058) has the molecular formula C26H23N2O2+ and a molecular weight of 395.48 g/mol. Its IUPAC name is (2Z)-2-[(6-methoxy-1-methylquinolin-1-ium-2-yl)methylidene]-3-methyl-5-phenyl-1,3-benzoxazole.
| Compound Name | (2Z)-2-[(6-methoxy-1-methylquinolin-1-ium-2-yl)methylidene]-3-methyl-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 71036058 |
| Molecular Formula | C26H23N2O2+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2Z)-2-[(6-methoxy-1-methylquinolin-1-ium-2-yl)methylidene]-3-methyl-5-phenyl-1,3-benzoxazole |
| SMILES | COc1ccc2c(ccc(/C=C3\Oc4ccc(-c5ccccc5)cc4N3C)[n+]2C)c1 |
| InChI | InChI=1S/C26H23N2O2/c1-27-21(11-9-20-15-22(29-3)12-13-23(20)27)17-26-28(2)24-16-19(10-14-25(24)30-26)18-7-5-4-6-8-18/h4-17H,1-3H3/q+1 |
| InChIKey | YJLWXZLYXLACLR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|