C29H25N3O7S3 — CID 59971062
[2-[[3-(ethylaminooxysulfonylmethyl)-5-phenyl-1,3-benzoxazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonate (PubChem CID 59971062) has the molecular formula C29H25N3O7S3 and a molecular weight of 623.73 g/mol. Its IUPAC name is [2-[[3-(ethylaminooxysulfonylmethyl)-5-phenyl-1,3-benzoxazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonate.
| Compound Name | [2-[[3-(ethylaminooxysulfonylmethyl)-5-phenyl-1,3-benzoxazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 59971062 |
| Molecular Formula | C29H25N3O7S3 |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.09 |
| IUPAC Name | [2-[[3-(ethylaminooxysulfonylmethyl)-5-phenyl-1,3-benzoxazol-2-ylidene]methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]methanesulfonate |
| SMILES | CCNOS(=O)(=O)CN1C(=Cc2sc3ccc4ccccc4c3[n+]2CS(=O)(=O)[O-])Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C29H25N3O7S3/c1-2-30-39-42(36,37)19-31-24-16-22(20-8-4-3-5-9-20)12-14-25(24)38-27(31)17-28-32(18-41(33,34)35)29-23-11-7-6-10-21(23)13-15-26(29)40-28/h3-17,30H,2,18-19H2,1H3 |
| InChIKey | DAMSEOOKVGPMRW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|