C26H30N3OS+ — CID 3149307
N-[1-ethyl-2-[(3-pentyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-6-yl]acetamide (PubChem CID 3149307) has the molecular formula C26H30N3OS+ and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[1-ethyl-2-[(3-pentyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-6-yl]acetamide.
| Compound Name | N-[1-ethyl-2-[(3-pentyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-6-yl]acetamide |
|---|---|
| PubChem CID | 3149307 |
| Molecular Formula | C26H30N3OS+ |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-[1-ethyl-2-[(3-pentyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-6-yl]acetamide |
| SMILES | CCCCCN1C(=Cc2ccc3cc(NC(C)=O)ccc3[n+]2CC)Sc2ccccc21 |
| InChI | InChI=1S/C26H29N3OS/c1-4-6-9-16-29-24-10-7-8-11-25(24)31-26(29)18-22-14-12-20-17-21(27-19(3)30)13-15-23(20)28(22)5-2/h7-8,10-15,17-18H,4-6,9,16H2,1-3H3/p+1 |
| InChIKey | SNBNUWJQBJCXDR-UHFFFAOYSA-O |
| XLogP | 6.21 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|