C26H31I2N3O — CID 74393254
trimethyl-[3-[4-[3-(3-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium diiodide (PubChem CID 74393254) has the molecular formula C26H31I2N3O and a molecular weight of 655.36 g/mol. Its IUPAC name is trimethyl-[3-[4-[3-(3-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium diiodide.
| Compound Name | trimethyl-[3-[4-[3-(3-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium diiodide |
|---|---|
| PubChem CID | 74393254 |
| Molecular Formula | C26H31I2N3O |
| Molecular Weight | 655.36 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | trimethyl-[3-[4-[3-(3-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium diiodide |
| SMILES | CN1C(=CC=Cc2cc[n+](CCC[N+](C)(C)C)c3ccccc23)Oc2ccccc21.[I-].[I-] |
| InChI | InChI=1S/C26H31N3O.2HI/c1-27-24-14-7-8-15-25(24)30-26(27)16-9-11-21-17-19-28(18-10-20-29(2,3)4)23-13-6-5-12-22(21)23;;/h5-9,11-17,19H,10,18,20H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | ZVUUXEGAYWQURQ-UHFFFAOYSA-L |
| XLogP | -1.38 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.36 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|