C35H50N6O+2 — CID 58675745
trimethyl-[3-[2-[3-[1-[3-(1,4,7-triazecan-4-yl)propyl]quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]propyl]azanium (PubChem CID 58675745) has the molecular formula C35H50N6O+2 and a molecular weight of 570.83 g/mol. Its IUPAC name is trimethyl-[3-[2-[3-[1-[3-(1,4,7-triazecan-4-yl)propyl]quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]propyl]azanium.
| Compound Name | trimethyl-[3-[2-[3-[1-[3-(1,4,7-triazecan-4-yl)propyl]quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]propyl]azanium |
|---|---|
| PubChem CID | 58675745 |
| Molecular Formula | C35H50N6O+2 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | trimethyl-[3-[2-[3-[1-[3-(1,4,7-triazecan-4-yl)propyl]quinolin-1-ium-4-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]propyl]azanium |
| SMILES | C[N+](C)(C)CCCN1C(=CC=Cc2cc[n+](CCCN3CCNCCCNCC3)c3ccccc23)Oc2ccccc21 |
| InChI | InChI=1S/C35H50N6O/c1-41(2,3)29-11-25-40-33-15-6-7-16-34(33)42-35(40)17-8-12-30-18-26-39(32-14-5-4-13-31(30)32)24-10-23-38-27-21-36-19-9-20-37-22-28-38/h4-8,12-18,26,36-37H,9-11,19-25,27-29H2,1-3H3/q+2 |
| InChIKey | UZCGLKYKWTZCKG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|