C26H27N2O+ — CID 59929357
(2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzoxazole (PubChem CID 59929357) has the molecular formula C26H27N2O+ and a molecular weight of 383.52 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzoxazole.
| Compound Name | (2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzoxazole |
|---|---|
| PubChem CID | 59929357 |
| Molecular Formula | C26H27N2O+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzoxazole |
| SMILES | CCN1/C(=C/C=C(C)\C=C\c2cc[n+](CC)c3ccccc23)Oc2ccccc21 |
| InChI | InChI=1S/C26H27N2O/c1-4-27-19-18-21(22-10-6-7-11-23(22)27)16-14-20(3)15-17-26-28(5-2)24-12-8-9-13-25(24)29-26/h6-19H,4-5H2,1-3H3/q+1 |
| InChIKey | FQEITYREKSJOQP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|