C30H23N2O3S+ — CID 72511073
2-[3-(furan-2-yl)-5-(1-prop-1-ynoxyquinolin-1-ium-4-yl)penta-2,4-dienylidene]-9-oxa-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (PubChem CID 72511073) has the molecular formula C30H23N2O3S+ and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-5-(1-prop-1-ynoxyquinolin-1-ium-4-yl)penta-2,4-dienylidene]-9-oxa-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
| Compound Name | 2-[3-(furan-2-yl)-5-(1-prop-1-ynoxyquinolin-1-ium-4-yl)penta-2,4-dienylidene]-9-oxa-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene |
|---|---|
| PubChem CID | 72511073 |
| Molecular Formula | C30H23N2O3S+ |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-[3-(furan-2-yl)-5-(1-prop-1-ynoxyquinolin-1-ium-4-yl)penta-2,4-dienylidene]-9-oxa-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene |
| SMILES | CC#CO[n+]1ccc(C=CC(=CC=C2Sc3cccc4c3N2CCO4)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C30H23N2O3S/c1-2-19-35-32-17-16-22(24-7-3-4-8-25(24)32)12-13-23(26-10-6-20-33-26)14-15-29-31-18-21-34-27-9-5-11-28(36-29)30(27)31/h3-17,20H,18,21H2,1H3/q+1 |
| InChIKey | IBLDGOIYNOGCHW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 38.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|