C18H13NO2S — CID 58793489
(2Z)-1-(furan-2-yl)-2-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)ethanone (PubChem CID 58793489) has the molecular formula C18H13NO2S and a molecular weight of 307.37 g/mol. Its IUPAC name is (2Z)-1-(furan-2-yl)-2-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)ethanone.
| Compound Name | (2Z)-1-(furan-2-yl)-2-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 58793489 |
| Molecular Formula | C18H13NO2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (2Z)-1-(furan-2-yl)-2-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)ethanone |
| SMILES | CN1/C(=C/C(=O)c2ccco2)Sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C18H13NO2S/c1-19-17(11-14(20)15-7-4-10-21-15)22-16-9-8-12-5-2-3-6-13(12)18(16)19/h2-11H,1H3/b17-11- |
| InChIKey | ZVPUDGWBGFCMCR-BOPFTXTBSA-N |
| XLogP | 4.70 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|