C26H19NOS — CID 141149436
2-(3-methyl-5-phenyl-1,3-benzothiazol-2-ylidene)-1-naphthalen-1-ylethanone (PubChem CID 141149436) has the molecular formula C26H19NOS and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-(3-methyl-5-phenyl-1,3-benzothiazol-2-ylidene)-1-naphthalen-1-ylethanone.
| Compound Name | 2-(3-methyl-5-phenyl-1,3-benzothiazol-2-ylidene)-1-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 141149436 |
| Molecular Formula | C26H19NOS |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-(3-methyl-5-phenyl-1,3-benzothiazol-2-ylidene)-1-naphthalen-1-ylethanone |
| SMILES | CN1C(=CC(=O)c2cccc3ccccc23)Sc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H19NOS/c1-27-23-16-20(18-8-3-2-4-9-18)14-15-25(23)29-26(27)17-24(28)22-13-7-11-19-10-5-6-12-21(19)22/h2-17H,1H3 |
| InChIKey | AHUCBOQMINBMMW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|