C16H12N2O4 — CID 59999777
N'-(2-hydroxynaphthalene-1-carbonyl)furan-2-carbohydrazide (PubChem CID 59999777) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is N'-(2-hydroxynaphthalene-1-carbonyl)furan-2-carbohydrazide.
| Compound Name | N'-(2-hydroxynaphthalene-1-carbonyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 59999777 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N'-(2-hydroxynaphthalene-1-carbonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1c(O)ccc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C16H12N2O4/c19-12-8-7-10-4-1-2-5-11(10)14(12)16(21)18-17-15(20)13-6-3-9-22-13/h1-9,19H,(H,17,20)(H,18,21) |
| InChIKey | CQBLWTXYCYLBLW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|