C20H23N2S+ — CID 3995731
3-ethyl-5,6-dimethyl-2-[3-(1-methylpyridin-1-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole (PubChem CID 3995731) has the molecular formula C20H23N2S+ and a molecular weight of 323.49 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-2-[3-(1-methylpyridin-1-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole.
| Compound Name | 3-ethyl-5,6-dimethyl-2-[3-(1-methylpyridin-1-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3995731 |
| Molecular Formula | C20H23N2S+ |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-2-[3-(1-methylpyridin-1-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole |
| SMILES | CCN1C(=CC=Cc2cccc[n+]2C)Sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C20H23N2S/c1-5-22-18-13-15(2)16(3)14-19(18)23-20(22)11-8-10-17-9-6-7-12-21(17)4/h6-14H,5H2,1-4H3/q+1 |
| InChIKey | BTKZDEXLGRNRLE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|