C21H25IN5O3S2+ — CID 73203059
4-[2-[[7-(3-iodopropyl)-3-methylpurin-3-ium-6-yl]methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid (PubChem CID 73203059) has the molecular formula C21H25IN5O3S2+ and a molecular weight of 586.50 g/mol. Its IUPAC name is 4-[2-[[7-(3-iodopropyl)-3-methylpurin-3-ium-6-yl]methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[[7-(3-iodopropyl)-3-methylpurin-3-ium-6-yl]methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 73203059 |
| Molecular Formula | C21H25IN5O3S2+ |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | 4-[2-[[7-(3-iodopropyl)-3-methylpurin-3-ium-6-yl]methylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid |
| SMILES | C[n+]1cnc(C=C2Sc3ccccc3N2CCCCS(=O)(=O)O)c2c1ncn2CCCI |
| InChI | InChI=1S/C21H24IN5O3S2/c1-25-14-23-16(20-21(25)24-15-26(20)10-6-9-22)13-19-27(11-4-5-12-32(28,29)30)17-7-2-3-8-18(17)31-19/h2-3,7-8,13-15H,4-6,9-12H2,1H3/p+1 |
| InChIKey | FLVFCNIAQRZRNP-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|