C32H27N3O3S3 — CID 59832382
3-[(2E)-2-[[2-(4-aminophenyl)sulfanyl-1-phenylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 59832382) has the molecular formula C32H27N3O3S3 and a molecular weight of 597.79 g/mol. Its IUPAC name is 3-[(2E)-2-[[2-(4-aminophenyl)sulfanyl-1-phenylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[[2-(4-aminophenyl)sulfanyl-1-phenylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59832382 |
| Molecular Formula | C32H27N3O3S3 |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | 3-[(2E)-2-[[2-(4-aminophenyl)sulfanyl-1-phenylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | Nc1ccc(Sc2cc(/C=C3/Sc4ccccc4N3CCCS(=O)(=O)[O-])c3ccccc3[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H27N3O3S3/c33-24-15-17-26(18-16-24)39-32-22-23(27-11-4-5-12-28(27)35(32)25-9-2-1-3-10-25)21-31-34(19-8-20-41(36,37)38)29-13-6-7-14-30(29)40-31/h1-7,9-18,21-22H,8,19-20,33H2 |
| InChIKey | WBYVNBTYFUKQOZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|