C31H33N3S2+2 — CID 87597251
trimethyl-[2-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]sulfanylethyl]azanium (PubChem CID 87597251) has the molecular formula C31H33N3S2+2 and a molecular weight of 511.76 g/mol. Its IUPAC name is trimethyl-[2-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]sulfanylethyl]azanium.
| Compound Name | trimethyl-[2-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]sulfanylethyl]azanium |
|---|---|
| PubChem CID | 87597251 |
| Molecular Formula | C31H33N3S2+2 |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | trimethyl-[2-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]sulfanylethyl]azanium |
| SMILES | CN1/C(=C\C=C\c2cc(SCC[N+](C)(C)C)[n+](-c3ccccc3)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C31H33N3S2/c1-32-28-18-10-11-19-29(28)36-30(32)20-12-13-24-23-31(35-22-21-34(2,3)4)33(25-14-6-5-7-15-25)27-17-9-8-16-26(24)27/h5-20,23H,21-22H2,1-4H3/q+2 |
| InChIKey | QGLQOPKPAZSXQA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|