C37H36IN3S — CID 140668947
N-ethyl-N-[[4-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]phenyl]methyl]ethanamine iodide (PubChem CID 140668947) has the molecular formula C37H36IN3S and a molecular weight of 681.69 g/mol. Its IUPAC name is N-ethyl-N-[[4-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]phenyl]methyl]ethanamine iodide.
| Compound Name | N-ethyl-N-[[4-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]phenyl]methyl]ethanamine iodide |
|---|---|
| PubChem CID | 140668947 |
| Molecular Formula | C37H36IN3S |
| Molecular Weight | 681.69 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | N-ethyl-N-[[4-[4-[(E,3E)-3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1-phenylquinolin-1-ium-2-yl]phenyl]methyl]ethanamine iodide |
| SMILES | CCN(CC)Cc1ccc(-c2cc(/C=C/C=C3/Sc4ccccc4N3C)c3ccccc3[n+]2-c2ccccc2)cc1.[I-] |
| InChI | InChI=1S/C37H36N3S.HI/c1-4-39(5-2)27-28-22-24-29(25-23-28)35-26-30(14-13-21-37-38(3)34-19-11-12-20-36(34)41-37)32-17-9-10-18-33(32)40(35)31-15-7-6-8-16-31;/h6-26H,4-5,27H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HKOAFMHSMNCAQP-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|