C37H37N4O2S+ — CID 25206498
2,3-dimethyl-5-[methyl-[3-[methyl-[4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]amino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 25206498) has the molecular formula C37H37N4O2S+ and a molecular weight of 601.80 g/mol. Its IUPAC name is 2,3-dimethyl-5-[methyl-[3-[methyl-[4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]amino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethyl-5-[methyl-[3-[methyl-[4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]amino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 25206498 |
| Molecular Formula | C37H37N4O2S+ |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 2,3-dimethyl-5-[methyl-[3-[methyl-[4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]amino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(N(C)CCCN(C)c2cc(/C=C3/Sc4ccccc4N3C)c3ccccc3[n+]2-c2ccccc2)=CC1=O |
| InChI | InChI=1S/C37H37N4O2S/c1-25-26(2)37(43)32(24-33(25)42)38(3)20-13-21-39(4)35-22-27(23-36-40(5)31-18-11-12-19-34(31)44-36)29-16-9-10-17-30(29)41(35)28-14-7-6-8-15-28/h6-12,14-19,22-24H,13,20-21H2,1-5H3/q+1 |
| InChIKey | HJFAEXNPRSVVJX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 47.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|