C38H42N4OS+2 — CID 154597277
(3-methoxyphenyl)methyl-dimethyl-[3-[methyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]azanium (PubChem CID 154597277) has the molecular formula C38H42N4OS+2 and a molecular weight of 602.85 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl-dimethyl-[3-[methyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]azanium.
| Compound Name | (3-methoxyphenyl)methyl-dimethyl-[3-[methyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]azanium |
|---|---|
| PubChem CID | 154597277 |
| Molecular Formula | C38H42N4OS+2 |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | (3-methoxyphenyl)methyl-dimethyl-[3-[methyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]azanium |
| SMILES | COc1cccc(C[N+](C)(C)CCCN(C)c2cc(C=C3Sc4ccccc4N3C)c3ccccc3[n+]2-c2ccccc2)c1 |
| InChI | InChI=1S/C38H42N4OS/c1-39(23-14-24-42(3,4)28-29-15-13-18-32(25-29)43-5)37-26-30(27-38-40(2)35-21-11-12-22-36(35)44-38)33-19-9-10-20-34(33)41(37)31-16-7-6-8-17-31/h6-13,15-22,25-27H,14,23-24,28H2,1-5H3/q+2 |
| InChIKey | YYOFBPYTRJIJHM-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|