C35H44N4O2S+2 — CID 77106105
2-hydroxyethyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium (PubChem CID 77106105) has the molecular formula C35H44N4O2S+2 and a molecular weight of 584.83 g/mol. Its IUPAC name is 2-hydroxyethyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium.
| Compound Name | 2-hydroxyethyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 77106105 |
| Molecular Formula | C35H44N4O2S+2 |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 2-hydroxyethyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium |
| SMILES | CCCN(CCC[N+](C)(C)CCO)c1cc(/C=C2\Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C35H44N4O2S/c1-6-19-37(20-12-21-39(3,4)22-23-40)34-24-27(25-35-36(2)31-15-10-11-16-33(31)42-35)30-18-17-29(41-5)26-32(30)38(34)28-13-8-7-9-14-28/h7-11,13-18,24-26,40H,6,12,19-23H2,1-5H3/q+2 |
| InChIKey | MYBGEUUYIULOCG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 39.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|