C40H46N4OS+2 — CID 77106107
benzyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium (PubChem CID 77106107) has the molecular formula C40H46N4OS+2 and a molecular weight of 630.90 g/mol. Its IUPAC name is benzyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium.
| Compound Name | benzyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 77106107 |
| Molecular Formula | C40H46N4OS+2 |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | benzyl-[3-[[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl]-dimethylazanium |
| SMILES | CCCN(CCC[N+](C)(C)Cc1ccccc1)c1cc(/C=C2\Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C40H46N4OS/c1-6-24-42(25-15-26-44(3,4)30-31-16-9-7-10-17-31)39-27-32(28-40-41(2)36-20-13-14-21-38(36)46-40)35-23-22-34(45-5)29-37(35)43(39)33-18-11-8-12-19-33/h7-14,16-23,27-29H,6,15,24-26,30H2,1-5H3/q+2 |
| InChIKey | QAYXLSXSKWXUGW-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|