C20H29IN2S — CID 139604449
4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-bis(2-methylpropyl)buta-1,3-dien-1-amine iodide (PubChem CID 139604449) has the molecular formula C20H29IN2S and a molecular weight of 456.44 g/mol. Its IUPAC name is 4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-bis(2-methylpropyl)buta-1,3-dien-1-amine iodide.
| Compound Name | 4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-bis(2-methylpropyl)buta-1,3-dien-1-amine iodide |
|---|---|
| PubChem CID | 139604449 |
| Molecular Formula | C20H29IN2S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-N,N-bis(2-methylpropyl)buta-1,3-dien-1-amine iodide |
| SMILES | CC(C)CN(C=CC=Cc1sc2ccccc2[n+]1C)CC(C)C.[I-] |
| InChI | InChI=1S/C20H29N2S.HI/c1-16(2)14-22(15-17(3)4)13-9-8-12-20-21(5)18-10-6-7-11-19(18)23-20;/h6-13,16-17H,14-15H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | QLNGBWYSGCKPKH-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|