C30H32Cl2N3O6S3+ — CID 59902778
3-[2-[(E,3E)-3-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)butyl]benzimidazol-2-ylidene]prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 59902778) has the molecular formula C30H32Cl2N3O6S3+ and a molecular weight of 697.71 g/mol. Its IUPAC name is 3-[2-[(E,3E)-3-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)butyl]benzimidazol-2-ylidene]prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E,3E)-3-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)butyl]benzimidazol-2-ylidene]prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59902778 |
| Molecular Formula | C30H32Cl2N3O6S3+ |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 696.08 |
| IUPAC Name | 3-[2-[(E,3E)-3-[5,6-dichloro-1-ethyl-3-[3-(trioxidanylsulfanyl)butyl]benzimidazol-2-ylidene]prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C\C=C\c2sc3ccc4ccccc4c3[n+]2CCCS(=O)(=O)O)N(CCC(C)SOOO)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C30H31Cl2N3O6S3/c1-3-33-25-18-23(31)24(32)19-26(25)34(16-14-20(2)43-41-40-36)28(33)10-6-11-29-35(15-7-17-44(37,38)39)30-22-9-5-4-8-21(22)12-13-27(30)42-29/h4-6,8-13,18-20H,3,7,14-17H2,1-2H3,(H-,36,37,38,39)/p+1 |
| InChIKey | AIBKBHNTPVNFQU-UHFFFAOYSA-O |
| XLogP | 7.98 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|