C26H25BrN2O4S3 — CID 20600412
3-[2-[(E)-2-[(Z)-(5-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]furo[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 20600412) has the molecular formula C26H25BrN2O4S3 and a molecular weight of 605.60 g/mol. Its IUPAC name is 3-[2-[(E)-2-[(Z)-(5-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]furo[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-[(Z)-(5-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]furo[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20600412 |
| Molecular Formula | C26H25BrN2O4S3 |
| Molecular Weight | 605.60 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | 3-[2-[(E)-2-[(Z)-(5-bromo-3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]furo[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(/C=C1\Sc2ccc(Br)cc2N1CC)=C\c1sc2ccc3ccoc3c2[n+]1CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C26H25BrN2O4S3/c1-3-17(14-23-28(4-2)20-16-19(27)7-9-21(20)34-23)15-24-29(11-5-13-36(30,31)32)25-22(35-24)8-6-18-10-12-33-26(18)25/h6-10,12,14-16H,3-5,11,13H2,1-2H3 |
| InChIKey | OSSXDFZQPSCYNN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|