C31H43N4O2S2+3 — CID 167712622
3-[6-hydroxy-2-[5-[6-hydroxy-3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium (PubChem CID 167712622) has the molecular formula C31H43N4O2S2+3 and a molecular weight of 567.85 g/mol. Its IUPAC name is 3-[6-hydroxy-2-[5-[6-hydroxy-3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium.
| Compound Name | 3-[6-hydroxy-2-[5-[6-hydroxy-3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 167712622 |
| Molecular Formula | C31H43N4O2S2+3 |
| Molecular Weight | 567.85 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 3-[6-hydroxy-2-[5-[6-hydroxy-3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN1C(=CC=CC=Cc2sc3cc(O)ccc3[n+]2CCC[N+](C)(C)C)Sc2cc(O)ccc21 |
| InChI | InChI=1S/C31H41N4O2S2/c1-34(2,3)20-10-18-32-26-16-14-24(36)22-28(26)38-30(32)12-8-7-9-13-31-33(19-11-21-35(4,5)6)27-17-15-25(37)23-29(27)39-31/h7-9,12-17,22-23H,10-11,18-21H2,1-6H3/q+1/p+2 |
| InChIKey | JGKGNZBVYMFIQO-UHFFFAOYSA-P |
| XLogP | 5.82 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.85 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|