C26H22N3O4S2+ — CID 123782022
3-[2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 123782022) has the molecular formula C26H22N3O4S2+ and a molecular weight of 504.61 g/mol. Its IUPAC name is 3-[2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 123782022 |
| Molecular Formula | C26H22N3O4S2+ |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 3-[2-[3-cyano-5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | N#CC(C=Cc1sc2ccccc2[n+]1CCC(=O)O)=CC=C1Sc2ccccc2N1CCOC=O |
| InChI | InChI=1S/C26H21N3O4S2/c27-17-19(9-11-24-28(14-13-26(31)32)20-5-1-3-7-22(20)34-24)10-12-25-29(15-16-33-18-30)21-6-2-4-8-23(21)35-25/h1-12,18H,13-16H2/p+1 |
| InChIKey | VXIMJDPECWKIAJ-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|