C25H24ClN3O3S2 — CID 98157087
4-chloro-N-[(5Z)-4-oxo-3-prop-2-enyl-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 98157087) has the molecular formula C25H24ClN3O3S2 and a molecular weight of 514.07 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-4-oxo-3-prop-2-enyl-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(5Z)-4-oxo-3-prop-2-enyl-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 98157087 |
| Molecular Formula | C25H24ClN3O3S2 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 4-chloro-N-[(5Z)-4-oxo-3-prop-2-enyl-5-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | C=CCN1C(=O)/C(=C/C=C2/N(C)c3ccccc3C2(C)C)SC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O3S2/c1-5-16-29-23(30)21(33-24(29)27-34(31,32)18-12-10-17(26)11-13-18)14-15-22-25(2,3)19-8-6-7-9-20(19)28(22)4/h5-15H,1,16H2,2-4H3/b21-14-,22-15+,27-24? |
| InChIKey | WGYIVXGPTRTIFE-PWEDAADHSA-N |
| XLogP | 5.34 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|