C14H18N2O3S3 — CID 51575167
N-[(5R)-3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 51575167) has the molecular formula C14H18N2O3S3 and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[(5R)-3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[(5R)-3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 51575167 |
| Molecular Formula | C14H18N2O3S3 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[(5R)-3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | C[C@H]1SC(=NS(=O)(=O)c2cccs2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C14H18N2O3S3/c1-10-13(17)16(11-6-3-2-4-7-11)14(21-10)15-22(18,19)12-8-5-9-20-12/h5,8-11H,2-4,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | UIUVFACNPCTHQZ-SNVBAGLBSA-N |
| XLogP | 3.09 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|