C16H21N3O3S3 — CID 7273285
N-[(5E)-3-cyclohexyl-5-(dimethylaminomethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide (PubChem CID 7273285) has the molecular formula C16H21N3O3S3 and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[(5E)-3-cyclohexyl-5-(dimethylaminomethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | N-[(5E)-3-cyclohexyl-5-(dimethylaminomethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7273285 |
| Molecular Formula | C16H21N3O3S3 |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-[(5E)-3-cyclohexyl-5-(dimethylaminomethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CN(C)/C=C1/SC(=NS(=O)(=O)c2cccs2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C16H21N3O3S3/c1-18(2)11-13-15(20)19(12-7-4-3-5-8-12)16(24-13)17-25(21,22)14-9-6-10-23-14/h6,9-12H,3-5,7-8H2,1-2H3/b13-11+,17-16? |
| InChIKey | BVRGSDBANJJEIB-GMJMYNDESA-N |
| XLogP | 3.10 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|