C18H24N2O3S2 — CID 4520715
N-(3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)-4-ethylbenzenesulfonamide (PubChem CID 4520715) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-(3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)-4-ethylbenzenesulfonamide.
| Compound Name | N-(3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4520715 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(3-cyclohexyl-5-methyl-4-oxo-1,3-thiazolidin-2-ylidene)-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N=C2SC(C)C(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O3S2/c1-3-14-9-11-16(12-10-14)25(22,23)19-18-20(17(21)13(2)24-18)15-7-5-4-6-8-15/h9-13,15H,3-8H2,1-2H3 |
| InChIKey | PVYPAXOHQROAFD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|