C27H23N3O4S2 — CID 3770085
2-(4-acetylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3770085) has the molecular formula C27H23N3O4S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-(4-acetylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-acetylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3770085 |
| Molecular Formula | C27H23N3O4S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 2-(4-acetylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\c3ccc(C(C)=O)cc3)N(c3ccc(O)cc3)C2=O)Sc2ccc(OC)cc21 |
| InChI | InChI=1S/C27H23N3O4S2/c1-4-29-22-15-21(34-3)13-14-23(22)35-26(29)24-25(33)30(19-9-11-20(32)12-10-19)27(36-24)28-18-7-5-17(6-8-18)16(2)31/h5-15,32H,4H2,1-3H3/b26-24?,28-27- |
| InChIKey | SQEHKTMZXGNYNP-OSXSRTQZSA-N |
| XLogP | 6.17 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|