C27H22N4OS3 — CID 6111274
(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-3-(3-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 6111274) has the molecular formula C27H22N4OS3 and a molecular weight of 514.70 g/mol. Its IUPAC name is (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-3-(3-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-3-(3-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6111274 |
| Molecular Formula | C27H22N4OS3 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-[(2-methyl-1,3-benzothiazol-5-yl)imino]-3-(3-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCN1/C(=C2/S/C(=N\c3ccc4sc(C)nc4c3)N(c3cccc(C)c3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C27H22N4OS3/c1-4-30-21-10-5-6-11-23(21)34-26(30)24-25(32)31(19-9-7-8-16(2)14-19)27(35-24)29-18-12-13-22-20(15-18)28-17(3)33-22/h5-15H,4H2,1-3H3/b26-24-,29-27- |
| InChIKey | YRKFMVARSQXWIP-NPGLLJSBSA-N |
| XLogP | 7.48 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|