C20H16F3N3OS2 — CID 90385384
(5E)-3-ethyl-5-[3-methyl-6-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 90385384) has the molecular formula C20H16F3N3OS2 and a molecular weight of 435.50 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[3-methyl-6-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[3-methyl-6-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 90385384 |
| Molecular Formula | C20H16F3N3OS2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | (5E)-3-ethyl-5-[3-methyl-6-(trifluoromethyl)-1,3-benzothiazol-2-ylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2\Sc3cc(C(F)(F)F)ccc3N2C)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H16F3N3OS2/c1-3-26-17(27)16(29-19(26)24-13-7-5-4-6-8-13)18-25(2)14-10-9-12(20(21,22)23)11-15(14)28-18/h4-11H,3H2,1-2H3/b18-16+,24-19- |
| InChIKey | JHBSHYRGULJEIP-ATWSHMPWSA-N |
| XLogP | 5.70 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|