C21H17Cl2N4OS3+ — CID 76627375
2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-(6-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 76627375) has the molecular formula C21H17Cl2N4OS3+ and a molecular weight of 508.50 g/mol. Its IUPAC name is 2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-(6-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-(6-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 76627375 |
| Molecular Formula | C21H17Cl2N4OS3+ |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | 2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-(6-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Sc3cc(Cl)ccc3N2C)SC1=Nc1sc2cc(Cl)ccc2[n+]1C |
| InChI | InChI=1S/C21H17Cl2N4OS3/c1-4-27-18(28)17(19-25(2)13-7-5-11(22)9-15(13)29-19)31-21(27)24-20-26(3)14-8-6-12(23)10-16(14)30-20/h5-10H,4H2,1-3H3/q+1 |
| InChIKey | BIAJRHAXFKPZPE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 39.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|