C23H20Cl2N4OS2 — CID 135407781
(2Z,5Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-3-ethyl-5-(1-methylquinolin-2-ylidene)-1,3-thiazolidin-4-one chloride (PubChem CID 135407781) has the molecular formula C23H20Cl2N4OS2 and a molecular weight of 503.48 g/mol. Its IUPAC name is (2Z,5Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-3-ethyl-5-(1-methylquinolin-2-ylidene)-1,3-thiazolidin-4-one chloride.
| Compound Name | (2Z,5Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-3-ethyl-5-(1-methylquinolin-2-ylidene)-1,3-thiazolidin-4-one chloride |
|---|---|
| PubChem CID | 135407781 |
| Molecular Formula | C23H20Cl2N4OS2 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | (2Z,5Z)-2-[(6-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-3-ethyl-5-(1-methylquinolin-2-ylidene)-1,3-thiazolidin-4-one chloride |
| SMILES | CCN1C(=O)/C(=C2\C=Cc3ccccc3N2C)S/C1=N\c1sc2cc(Cl)ccc2[n+]1C.[Cl-] |
| InChI | InChI=1S/C23H20ClN4OS2.ClH/c1-4-28-21(29)20(18-11-9-14-7-5-6-8-16(14)26(18)2)31-23(28)25-22-27(3)17-12-10-15(24)13-19(17)30-22;/h5-13H,4H2,1-3H3;1H/q+1;/p-1/b20-18-; |
| InChIKey | ARHJKZACYCBUJM-GQQUDWLYSA-M |
| XLogP | 2.34 |
| TPSA | 39.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_J(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|