C25H23ClN4OS2 — CID 158752076
(5Z)-3-ethyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-[(2Z)-2-(1-methylquinolin-2-ylidene)ethylidene]-1,3-thiazolidin-4-one chloride (PubChem CID 158752076) has the molecular formula C25H23ClN4OS2 and a molecular weight of 495.07 g/mol. Its IUPAC name is (5Z)-3-ethyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-[(2Z)-2-(1-methylquinolin-2-ylidene)ethylidene]-1,3-thiazolidin-4-one chloride.
| Compound Name | (5Z)-3-ethyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-[(2Z)-2-(1-methylquinolin-2-ylidene)ethylidene]-1,3-thiazolidin-4-one chloride |
|---|---|
| PubChem CID | 158752076 |
| Molecular Formula | C25H23ClN4OS2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (5Z)-3-ethyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)imino]-5-[(2Z)-2-(1-methylquinolin-2-ylidene)ethylidene]-1,3-thiazolidin-4-one chloride |
| SMILES | CCN1C(=O)/C(=C/C=C2/C=Cc3ccccc3N2C)SC1=Nc1sc2ccccc2[n+]1C.[Cl-] |
| InChI | InChI=1S/C25H23N4OS2.ClH/c1-4-29-23(30)22(16-15-18-14-13-17-9-5-6-10-19(17)27(18)2)32-25(29)26-24-28(3)20-11-7-8-12-21(20)31-24;/h5-16H,4H2,1-3H3;1H/q+1;/p-1/b18-15-,22-16-; |
| InChIKey | HHCZEBRSSZJEEN-CZBOPDHESA-M |
| XLogP | 2.24 |
| TPSA | 39.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|