C19H16FN3OS2 — CID 90385382
(5E)-3-ethyl-5-(7-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 90385382) has the molecular formula C19H16FN3OS2 and a molecular weight of 385.49 g/mol. Its IUPAC name is (5E)-3-ethyl-5-(7-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-(7-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 90385382 |
| Molecular Formula | C19H16FN3OS2 |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (5E)-3-ethyl-5-(7-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2\Sc3c(F)cccc3N2C)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C19H16FN3OS2/c1-3-23-17(24)16(26-19(23)21-12-8-5-4-6-9-12)18-22(2)14-11-7-10-13(20)15(14)25-18/h4-11H,3H2,1-2H3/b18-16+,21-19- |
| InChIKey | RVVVNXBUEXCBQL-DHZPKXATSA-N |
| XLogP | 4.82 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|