C24H27N3O3S2 — CID 3716436
3-ethyl-2-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3716436) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 3-ethyl-2-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-2-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3716436 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 3-ethyl-2-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Sc3ccc(OC)cc3N2C)S/C1=N\c1cc(C(C)C)c(O)cc1C |
| InChI | InChI=1S/C24H27N3O3S2/c1-7-27-22(29)21(23-26(5)18-11-15(30-6)8-9-20(18)31-23)32-24(27)25-17-12-16(13(2)3)19(28)10-14(17)4/h8-13,28H,7H2,1-6H3/b23-21?,25-24- |
| InChIKey | WALKKTFYVSEAMR-OJQMOGMSSA-N |
| XLogP | 5.83 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|