C38H52ClN3O2S2 — CID 3497516
2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one (PubChem CID 3497516) has the molecular formula C38H52ClN3O2S2 and a molecular weight of 682.44 g/mol. Its IUPAC name is 2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3497516 |
| Molecular Formula | C38H52ClN3O2S2 |
| Molecular Weight | 682.44 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | 2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-5-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-cyclohexyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=C2S/C(=N\CCCCOc3ccc(C(C)(C)CC)cc3C(C)(C)CC)N(C3CCCCC3)C2=O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C38H52ClN3O2S2/c1-8-37(4,5)26-18-20-31(29(24-26)38(6,7)9-2)44-23-15-14-22-40-36-42(28-16-12-11-13-17-28)34(43)33(46-36)35-41(10-3)30-25-27(39)19-21-32(30)45-35/h18-21,24-25,28H,8-17,22-23H2,1-7H3/b35-33?,40-36- |
| InChIKey | GHDLFNJDKVRSKO-VTOUQYMQSA-N |
| XLogP | 10.94 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.44 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|