C36H51N3O2S2 — CID 3740314
2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 3740314) has the molecular formula C36H51N3O2S2 and a molecular weight of 621.96 g/mol. Its IUPAC name is 2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3740314 |
| Molecular Formula | C36H51N3O2S2 |
| Molecular Weight | 621.96 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | 2-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylimino]-3-butyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccccc3N2CC)S/C1=N\CCCCOc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| InChI | InChI=1S/C36H51N3O2S2/c1-9-13-23-39-32(40)31(33-38(12-4)28-18-14-15-19-30(28)42-33)43-34(39)37-22-16-17-24-41-29-21-20-26(35(5,6)10-2)25-27(29)36(7,8)11-3/h14-15,18-21,25H,9-13,16-17,22-24H2,1-8H3/b33-31?,37-34- |
| InChIKey | SSSKNHHPMQPBDU-VWSNVAGCSA-N |
| XLogP | 9.75 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.96 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|