C26H23N3O6S — CID 18846659
3-[[(5Z)-5-[1-(carboxymethyl)-2-oxoindol-3-ylidene]-3-cyclohexyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 18846659) has the molecular formula C26H23N3O6S and a molecular weight of 505.55 g/mol. Its IUPAC name is 3-[[(5Z)-5-[1-(carboxymethyl)-2-oxoindol-3-ylidene]-3-cyclohexyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 3-[[(5Z)-5-[1-(carboxymethyl)-2-oxoindol-3-ylidene]-3-cyclohexyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 18846659 |
| Molecular Formula | C26H23N3O6S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 3-[[(5Z)-5-[1-(carboxymethyl)-2-oxoindol-3-ylidene]-3-cyclohexyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C2\S/C(=N\c3cccc(C(=O)O)c3)N(C3CCCCC3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C26H23N3O6S/c30-20(31)14-28-19-12-5-4-11-18(19)21(23(28)32)22-24(33)29(17-9-2-1-3-10-17)26(36-22)27-16-8-6-7-15(13-16)25(34)35/h4-8,11-13,17H,1-3,9-10,14H2,(H,30,31)(H,34,35)/b22-21-,27-26- |
| InChIKey | ARDOFMCWLKRZSO-NZOOFWCASA-N |
| XLogP | 4.12 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|